3-(methylthio)benzoic acid


3-(methylthio)benzoic acid
CAS RN:[825-99-0]
Formula:C8H8O2S; 168.22 g/mol
InChiKey:PZGADOOBMVLBJE-UHFFFAOYSA-N
SMILES:CSc1cccc(c1)C(O)=O
Molecular structure of 3-(methylthio)benzoic acid
Melting point:128 °C

Isomers

ethenylsulfonylbenzene
Molecular structure of ethenylsulfonylbenzene
4-mercaptophenylacetic acid
Molecular structure of 4-mercaptophenylacetic acid
methyl 4-sulfanylbenzoate
Molecular structure of methyl 4-sulfanylbenzoate
2-methylsulfanylbenzoic acid
Molecular structure of 2-methylsulfanylbenzoic acid
3-(methylthio)benzoic acid
Molecular structure of 3-(methylthio)benzoic acid
4-(methylthio)benzoic acid
Molecular structure of 4-(methylthio)benzoic acid
methyl thiosalicylate
Molecular structure of methyl thiosalicylate
phenyl(sulfanyl)acetic acid
Molecular structure of phenyl(sulfanyl)acetic acid
2-phenylsulfanylacetic acid
Molecular structure of 2-phenylsulfanylacetic acid